C10H14N2O4 — CID 167836434
methyl (E)-4-[[(3S)-5-oxopyrrolidine-3-carbonyl]amino]but-2-enoate (PubChem CID 167836434) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl (E)-4-[[(3S)-5-oxopyrrolidine-3-carbonyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[(3S)-5-oxopyrrolidine-3-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 167836434 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | methyl (E)-4-[[(3S)-5-oxopyrrolidine-3-carbonyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)[C@@H]1CNC(=O)C1 |
| InChI | InChI=1S/C10H14N2O4/c1-16-9(14)3-2-4-11-10(15)7-5-8(13)12-6-7/h2-3,7H,4-6H2,1H3,(H,11,15)(H,12,13)/b3-2+/t7-/m0/s1 |
| InChIKey | DZUBSGOPCRGSKR-AIYRYJHASA-N |
| XLogP | -1.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|