C27H32F3N3O5S2 — CID 167838334
[(1R,2R)-2-(dimethylamino)cyclohexyl] 2-[(2,5-dimethylphenyl)sulfanylmethyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 167838334) has the molecular formula C27H32F3N3O5S2 and a molecular weight of 599.70 g/mol. Its IUPAC name is [(1R,2R)-2-(dimethylamino)cyclohexyl] 2-[(2,5-dimethylphenyl)sulfanylmethyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,2R)-2-(dimethylamino)cyclohexyl] 2-[(2,5-dimethylphenyl)sulfanylmethyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167838334 |
| Molecular Formula | C27H32F3N3O5S2 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | [(1R,2R)-2-(dimethylamino)cyclohexyl] 2-[(2,5-dimethylphenyl)sulfanylmethyl]-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C)c(SCc2nc3sc(C(=O)O[C@@H]4CCCC[C@H]4N(C)C)c(C)c3c(=O)[nH]2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H31N3O3S2.C2HF3O2/c1-14-10-11-15(2)19(12-14)32-13-20-26-23(29)21-16(3)22(33-24(21)27-20)25(30)31-18-9-7-6-8-17(18)28(4)5;3-2(4,5)1(6)7/h10-12,17-18H,6-9,13H2,1-5H3,(H,26,27,29);(H,6,7)/t17-,18-;/m1./s1 |
| InChIKey | PPJQKIIZIILZSO-JAXOOIEVSA-N |
| XLogP | 5.87 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |