C18H19N3O3S2 — CID 33103689
2-[(2,5-dimethylphenyl)sulfanylmethyl]-N-methoxy-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 33103689) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfanylmethyl]-N-methoxy-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfanylmethyl]-N-methoxy-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 33103689 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfanylmethyl]-N-methoxy-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CONC(=O)c1sc2nc(CSc3cc(C)ccc3C)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C18H19N3O3S2/c1-9-5-6-10(2)12(7-9)25-8-13-19-16(22)14-11(3)15(17(23)21-24-4)26-18(14)20-13/h5-7H,8H2,1-4H3,(H,21,23)(H,19,20,22) |
| InChIKey | RNZPLKUVLKBYTG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|