C12H17N3O — CID 167838726
2-cyclopentyl-N-(4-methylpyrimidin-2-yl)acetamide (PubChem CID 167838726) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-cyclopentyl-N-(4-methylpyrimidin-2-yl)acetamide.
| Compound Name | 2-cyclopentyl-N-(4-methylpyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 167838726 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-cyclopentyl-N-(4-methylpyrimidin-2-yl)acetamide |
| SMILES | Cc1ccnc(NC(=O)CC2CCCC2)n1 |
| InChI | InChI=1S/C12H17N3O/c1-9-6-7-13-12(14-9)15-11(16)8-10-4-2-3-5-10/h6-7,10H,2-5,8H2,1H3,(H,13,14,15,16) |
| InChIKey | ATBXGPKZXQKANX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |