C19H24N4O3S — CID 2428955
2-cyclopentyl-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide (PubChem CID 2428955) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-cyclopentyl-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2428955 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-cyclopentyl-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)CC3CCCC3)cc2)n1 |
| InChI | InChI=1S/C19H24N4O3S/c1-13-11-14(2)21-19(20-13)23-27(25,26)17-9-7-16(8-10-17)22-18(24)12-15-5-3-4-6-15/h7-11,15H,3-6,12H2,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | OSCKYCHDAWPJBP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |