C14H14ClN5O3 — CID 167840047
3-[2-[4-(5-chloro-2-methoxyphenyl)triazol-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 167840047) has the molecular formula C14H14ClN5O3 and a molecular weight of 335.75 g/mol. Its IUPAC name is 3-[2-[4-(5-chloro-2-methoxyphenyl)triazol-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-(5-chloro-2-methoxyphenyl)triazol-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167840047 |
| Molecular Formula | C14H14ClN5O3 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-[2-[4-(5-chloro-2-methoxyphenyl)triazol-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(Cl)cc1-c1cn(CCN2C(=O)CNC2=O)nn1 |
| InChI | InChI=1S/C14H14ClN5O3/c1-23-12-3-2-9(15)6-10(12)11-8-19(18-17-11)4-5-20-13(21)7-16-14(20)22/h2-3,6,8H,4-5,7H2,1H3,(H,16,22) |
| InChIKey | UPIIKOFALMOZPG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|