C11H11ClN4O2S — CID 864613
1-(5-chloro-2-methoxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanylethanone (PubChem CID 864613) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.76 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanylethanone.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanylethanone |
|---|---|
| PubChem CID | 864613 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-2-(1-methyltetrazol-5-yl)sulfanylethanone |
| SMILES | COc1ccc(Cl)cc1C(=O)CSc1nnnn1C |
| InChI | InChI=1S/C11H11ClN4O2S/c1-16-11(13-14-15-16)19-6-9(17)8-5-7(12)3-4-10(8)18-2/h3-5H,6H2,1-2H3 |
| InChIKey | KYGHXDMJAJDIFD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |