C12H12Cl2N6OS — CID 71462935
N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 71462935) has the molecular formula C12H12Cl2N6OS and a molecular weight of 359.24 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 71462935 |
| Molecular Formula | C12H12Cl2N6OS |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | C/C(=N\NC(=O)CSc1nnnn1C)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H12Cl2N6OS/c1-7(9-5-8(13)3-4-10(9)14)15-16-11(21)6-22-12-17-18-19-20(12)2/h3-5H,6H2,1-2H3,(H,16,21)/b15-7+ |
| InChIKey | TYWUUZLAVXZOMC-VIZOYTHASA-N |
| XLogP | 2.15 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|