C15H22N2O5S — CID 167843901
3-[1-[4-(dimethylsulfamoyl)phenyl]ethylamino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 167843901) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-[1-[4-(dimethylsulfamoyl)phenyl]ethylamino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[1-[4-(dimethylsulfamoyl)phenyl]ethylamino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 167843901 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-[1-[4-(dimethylsulfamoyl)phenyl]ethylamino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(NC(=O)C(C)(C)C(=O)O)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C15H22N2O5S/c1-10(16-13(18)15(2,3)14(19)20)11-6-8-12(9-7-11)23(21,22)17(4)5/h6-10H,1-5H3,(H,16,18)(H,19,20) |
| InChIKey | OTXWZOVIGJHJQN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|