C20H14FN3O2S — CID 167844091
N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-fluoro-3-methoxypyridine-4-carboxamide (PubChem CID 167844091) has the molecular formula C20H14FN3O2S and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-fluoro-3-methoxypyridine-4-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-fluoro-3-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 167844091 |
| Molecular Formula | C20H14FN3O2S |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-fluoro-3-methoxypyridine-4-carboxamide |
| SMILES | COc1c(C(=O)Nc2ccccc2-c2nc3ccccc3s2)ccnc1F |
| InChI | InChI=1S/C20H14FN3O2S/c1-26-17-13(10-11-22-18(17)21)19(25)23-14-7-3-2-6-12(14)20-24-15-8-4-5-9-16(15)27-20/h2-11H,1H3,(H,23,25) |
| InChIKey | ZBGDKPZULCXXHU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|