C21H12F4N2O2S — CID 2235201
N-[2-(1,3-benzothiazol-2-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 2235201) has the molecular formula C21H12F4N2O2S and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 2235201 |
| Molecular Formula | C21H12F4N2O2S |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)Nc2ccccc2-c2nc3ccccc3s2)c(F)c1F |
| InChI | InChI=1S/C21H12F4N2O2S/c1-29-19-17(24)15(22)14(16(23)18(19)25)20(28)26-11-7-3-2-6-10(11)21-27-12-8-4-5-9-13(12)30-21/h2-9H,1H3,(H,26,28) |
| InChIKey | XFRFQGKBGLAJHZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|