About [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine
[2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine (PubChem CID 167844251) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine.
Molecular Properties
| Compound Name | [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine |
| PubChem CID | 167844251 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine |
| SMILES | NCC1CN(Cc2cc(-c3ccc4ccccc4c3)on2)CC12CCOCC2 |
| InChI | InChI=1S/C23H27N3O2/c24-13-20-14-26(16-23(20)7-9-27-10-8-23)15-21-12-22(28-25-21)19-6-5-17-3-1-2-4-18(17)11-19/h1-6,11-12,20H,7-10,13-16,24H2 |
| InChIKey | NHJCRWZQLNWJQS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine?
The IUPAC name of [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine (CID 167844251) is [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine.
What is the SMILES notation for [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine?
The canonical SMILES for [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine is NCC1CN(Cc2cc(-c3ccc4ccccc4c3)on2)CC12CCOCC2.
What is the InChIKey of [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine?
The InChIKey is NHJCRWZQLNWJQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c24-13-20-14-26(16-23(20)7-9-27-10-8-23)15-21-12-22(28-25-21)19-6-5-17-3-1-2-4-18(17)11-19/h1-6,11-12,20H,7-10,13-16,24H2.
What are the key properties of [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine?
[2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine has a molecular weight of 377.49 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-naphthalen-2-yl-1,2-oxazol-3-yl)methyl]-8-oxa-2-azaspiro[4.5]decan-4-yl]methanamine is sourced from PubChem (CID 167844251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).