C15H17N3O2 — CID 167845719
N-[3-(1H-indol-3-yl)propyl]-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 167845719) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[3-(1H-indol-3-yl)propyl]-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(1H-indol-3-yl)propyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 167845719 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-[3-(1H-indol-3-yl)propyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCc1c[nH]c2ccccc12)C1=NOCC1 |
| InChI | InChI=1S/C15H17N3O2/c19-15(14-7-9-20-18-14)16-8-3-4-11-10-17-13-6-2-1-5-12(11)13/h1-2,5-6,10,17H,3-4,7-9H2,(H,16,19) |
| InChIKey | HEYZNQURCHPYGT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|