C20H22N4O3 — CID 167845747
2-[4-(3,4-dimethoxyphenyl)triazol-1-yl]-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 167845747) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)triazol-1-yl]-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)triazol-1-yl]-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 167845747 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)triazol-1-yl]-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | COc1ccc(-c2cn(CC(=O)N[C@H](C)c3ccccc3)nn2)cc1OC |
| InChI | InChI=1S/C20H22N4O3/c1-14(15-7-5-4-6-8-15)21-20(25)13-24-12-17(22-23-24)16-9-10-18(26-2)19(11-16)27-3/h4-12,14H,13H2,1-3H3,(H,21,25)/t14-/m1/s1 |
| InChIKey | URNYQKREAYZCIS-CQSZACIVSA-N |
| XLogP | 2.84 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |