C29H32N4O2 — CID 167847342
2-butyl-N-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]-1-benzofuran-3-carboxamide (PubChem CID 167847342) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-butyl-N-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]-1-benzofuran-3-carboxamide.
| Compound Name | 2-butyl-N-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 167847342 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-butyl-N-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenyl]-1-benzofuran-3-carboxamide |
| SMILES | CCCCc1oc2ccccc2c1C(=O)Nc1ccc(CN2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C29H32N4O2/c1-2-3-9-26-28(24-8-4-5-10-25(24)35-26)29(34)31-23-14-12-22(13-15-23)21-32-17-19-33(20-18-32)27-11-6-7-16-30-27/h4-8,10-16H,2-3,9,17-21H2,1H3,(H,31,34) |
| InChIKey | VKNQTBNGVOZCRF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |