C21H31N5O — CID 167847885
2-[4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide (PubChem CID 167847885) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 167847885 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 2-[4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide |
| SMILES | CCN1CCN(CC(=O)N(C)C(C)c2ccccc2)CC1c1nccn1C |
| InChI | InChI=1S/C21H31N5O/c1-5-26-14-13-25(15-19(26)21-22-11-12-23(21)3)16-20(27)24(4)17(2)18-9-7-6-8-10-18/h6-12,17,19H,5,13-16H2,1-4H3 |
| InChIKey | CBNCAWUUEKHOTM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |