About [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol
[1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol (PubChem CID 167849359) has the molecular formula C16H18N6O
and a molecular weight of 310.36 g/mol. Its IUPAC name is [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol |
| PubChem CID | 167849359 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol |
| SMILES | Cn1nnc2c(N3CCCC3(CO)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C16H18N6O/c1-21-14-13(19-20-21)15(18-11-17-14)22-9-5-8-16(22,10-23)12-6-3-2-4-7-12/h2-4,6-7,11,23H,5,8-10H2,1H3 |
| InChIKey | UKPHPDMDACPRSI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol?
The IUPAC name of [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol (CID 167849359) is [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol?
The canonical SMILES for [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol is Cn1nnc2c(N3CCCC3(CO)c3ccccc3)ncnc21.
What is the InChIKey of [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol?
The InChIKey is UKPHPDMDACPRSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N6O/c1-21-14-13(19-20-21)15(18-11-17-14)22-9-5-8-16(22,10-23)12-6-3-2-4-7-12/h2-4,6-7,11,23H,5,8-10H2,1H3.
What are the key properties of [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol?
[1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol has a molecular weight of 310.36 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-methyltriazolo[4,5-d]pyrimidin-7-yl)-2-phenylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 167849359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).