C16H20N4OS — CID 167851301
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-thiophen-2-ylpyrazin-2-amine (PubChem CID 167851301) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-thiophen-2-ylpyrazin-2-amine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-thiophen-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 167851301 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-thiophen-2-ylpyrazin-2-amine |
| SMILES | c1csc(-c2cncc(NCC3CN4CCCC4CO3)n2)c1 |
| InChI | InChI=1S/C16H20N4OS/c1-3-12-11-21-13(10-20(12)5-1)7-18-16-9-17-8-14(19-16)15-4-2-6-22-15/h2,4,6,8-9,12-13H,1,3,5,7,10-11H2,(H,18,19) |
| InChIKey | BLKJDMLXCLTSCY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |