C18H22ClN3OS — CID 133451915
N-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-ylmethyl)-4-(2-chlorophenyl)-1,3-thiazol-2-amine (PubChem CID 133451915) has the molecular formula C18H22ClN3OS and a molecular weight of 363.91 g/mol. Its IUPAC name is N-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-ylmethyl)-4-(2-chlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-ylmethyl)-4-(2-chlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 133451915 |
| Molecular Formula | C18H22ClN3OS |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-ylmethyl)-4-(2-chlorophenyl)-1,3-thiazol-2-amine |
| SMILES | Clc1ccccc1-c1csc(NCC2CN3CCCCC3CO2)n1 |
| InChI | InChI=1S/C18H22ClN3OS/c19-16-7-2-1-6-15(16)17-12-24-18(21-17)20-9-14-10-22-8-4-3-5-13(22)11-23-14/h1-2,6-7,12-14H,3-5,8-11H2,(H,20,21) |
| InChIKey | WASJNGBHUKXWEH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |