C20H28N4O2 — CID 167851588
5-[1-[3-(oxan-4-yl)azepan-1-yl]ethyl]-3-pyridin-3-yl-1,2,4-oxadiazole (PubChem CID 167851588) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 5-[1-[3-(oxan-4-yl)azepan-1-yl]ethyl]-3-pyridin-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-[1-[3-(oxan-4-yl)azepan-1-yl]ethyl]-3-pyridin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 167851588 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 5-[1-[3-(oxan-4-yl)azepan-1-yl]ethyl]-3-pyridin-3-yl-1,2,4-oxadiazole |
| SMILES | CC(c1nc(-c2cccnc2)no1)N1CCCCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C20H28N4O2/c1-15(20-22-19(23-26-20)17-6-4-9-21-13-17)24-10-3-2-5-18(14-24)16-7-11-25-12-8-16/h4,6,9,13,15-16,18H,2-3,5,7-8,10-12,14H2,1H3 |
| InChIKey | FNDCGGYKNYWIJO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |