C14H16ClF2NO3 — CID 167852070
methyl 5-[(3-chloro-2-methylbenzoyl)amino]-3,3-difluoropentanoate (PubChem CID 167852070) has the molecular formula C14H16ClF2NO3 and a molecular weight of 319.74 g/mol. Its IUPAC name is methyl 5-[(3-chloro-2-methylbenzoyl)amino]-3,3-difluoropentanoate.
| Compound Name | methyl 5-[(3-chloro-2-methylbenzoyl)amino]-3,3-difluoropentanoate |
|---|---|
| PubChem CID | 167852070 |
| Molecular Formula | C14H16ClF2NO3 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | methyl 5-[(3-chloro-2-methylbenzoyl)amino]-3,3-difluoropentanoate |
| SMILES | COC(=O)CC(F)(F)CCNC(=O)c1cccc(Cl)c1C |
| InChI | InChI=1S/C14H16ClF2NO3/c1-9-10(4-3-5-11(9)15)13(20)18-7-6-14(16,17)8-12(19)21-2/h3-5H,6-8H2,1-2H3,(H,18,20) |
| InChIKey | BQXCJXXQLZDTML-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |