C18H19N5O5 — CID 167852396
1-[2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-3-[3-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]urea (PubChem CID 167852396) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 1-[2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-3-[3-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]urea.
| Compound Name | 1-[2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-3-[3-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 167852396 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)phenyl]-3-[3-(hydroxymethyl)-2,6-dioxopiperidin-3-yl]urea |
| SMILES | O=C1CCC(CO)(NC(=O)Nc2ccccc2-c2nc(C3CC3)no2)C(=O)N1 |
| InChI | InChI=1S/C18H19N5O5/c24-9-18(8-7-13(25)20-16(18)26)22-17(27)19-12-4-2-1-3-11(12)15-21-14(23-28-15)10-5-6-10/h1-4,10,24H,5-9H2,(H2,19,22,27)(H,20,25,26) |
| InChIKey | RCQCQGMADOFHFH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|