C15H16N4O2 — CID 167852623
N-cyclopropyl-5-[(4-methylbenzoyl)amino]-1H-pyrazole-4-carboxamide (PubChem CID 167852623) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-cyclopropyl-5-[(4-methylbenzoyl)amino]-1H-pyrazole-4-carboxamide.
| Compound Name | N-cyclopropyl-5-[(4-methylbenzoyl)amino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167852623 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-cyclopropyl-5-[(4-methylbenzoyl)amino]-1H-pyrazole-4-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2[nH]ncc2C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C15H16N4O2/c1-9-2-4-10(5-3-9)14(20)18-13-12(8-16-19-13)15(21)17-11-6-7-11/h2-5,8,11H,6-7H2,1H3,(H,17,21)(H2,16,18,19,20) |
| InChIKey | GZQCRCRUBXQXEG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |