C19H27NO4 — CID 167852658
3-hydroxy-4-methoxy-3-methyl-1-[4-(4-methylbenzoyl)piperidin-1-yl]butan-1-one (PubChem CID 167852658) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-hydroxy-4-methoxy-3-methyl-1-[4-(4-methylbenzoyl)piperidin-1-yl]butan-1-one.
| Compound Name | 3-hydroxy-4-methoxy-3-methyl-1-[4-(4-methylbenzoyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 167852658 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-hydroxy-4-methoxy-3-methyl-1-[4-(4-methylbenzoyl)piperidin-1-yl]butan-1-one |
| SMILES | COCC(C)(O)CC(=O)N1CCC(C(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C19H27NO4/c1-14-4-6-15(7-5-14)18(22)16-8-10-20(11-9-16)17(21)12-19(2,23)13-24-3/h4-7,16,23H,8-13H2,1-3H3 |
| InChIKey | MXHRRKGMMQSYSL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |