C16H16FN3O3 — CID 167853631
2-fluoro-5-[2-(3-hydroxypiperidin-1-yl)pyrimidin-5-yl]benzoic acid (PubChem CID 167853631) has the molecular formula C16H16FN3O3 and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-fluoro-5-[2-(3-hydroxypiperidin-1-yl)pyrimidin-5-yl]benzoic acid.
| Compound Name | 2-fluoro-5-[2-(3-hydroxypiperidin-1-yl)pyrimidin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 167853631 |
| Molecular Formula | C16H16FN3O3 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-fluoro-5-[2-(3-hydroxypiperidin-1-yl)pyrimidin-5-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2cnc(N3CCCC(O)C3)nc2)ccc1F |
| InChI | InChI=1S/C16H16FN3O3/c17-14-4-3-10(6-13(14)15(22)23)11-7-18-16(19-8-11)20-5-1-2-12(21)9-20/h3-4,6-8,12,21H,1-2,5,9H2,(H,22,23) |
| InChIKey | IPDYVVFNISTFBT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |