C20H17Cl2NO3 — CID 167854184
N-(3,3-dichlorocyclobutyl)-6-methoxy-3-phenyl-1-benzofuran-2-carboxamide (PubChem CID 167854184) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is N-(3,3-dichlorocyclobutyl)-6-methoxy-3-phenyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(3,3-dichlorocyclobutyl)-6-methoxy-3-phenyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 167854184 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-(3,3-dichlorocyclobutyl)-6-methoxy-3-phenyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2c(-c3ccccc3)c(C(=O)NC3CC(Cl)(Cl)C3)oc2c1 |
| InChI | InChI=1S/C20H17Cl2NO3/c1-25-14-7-8-15-16(9-14)26-18(17(15)12-5-3-2-4-6-12)19(24)23-13-10-20(21,22)11-13/h2-9,13H,10-11H2,1H3,(H,23,24) |
| InChIKey | KHFVVQAZFGCEPJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|