C22H20N4O3S — CID 56576859
N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-6-methoxy-3-phenyl-1-benzofuran-2-carboxamide (PubChem CID 56576859) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-6-methoxy-3-phenyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-6-methoxy-3-phenyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 56576859 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-6-methoxy-3-phenyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2c(-c3ccccc3)c(C(=O)NCc3n[nH]c(=S)n3C3CC3)oc2c1 |
| InChI | InChI=1S/C22H20N4O3S/c1-28-15-9-10-16-17(11-15)29-20(19(16)13-5-3-2-4-6-13)21(27)23-12-18-24-25-22(30)26(18)14-7-8-14/h2-6,9-11,14H,7-8,12H2,1H3,(H,23,27)(H,25,30) |
| InChIKey | VWYCSIAPCCVLPM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|