C17H19ClN6O — CID 167857495
[(4aS,7aS)-6-(6-chloro-5-methylpyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrimidin-5-ylmethanone (PubChem CID 167857495) has the molecular formula C17H19ClN6O and a molecular weight of 358.83 g/mol. Its IUPAC name is [(4aS,7aS)-6-(6-chloro-5-methylpyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrimidin-5-ylmethanone.
| Compound Name | [(4aS,7aS)-6-(6-chloro-5-methylpyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrimidin-5-ylmethanone |
|---|---|
| PubChem CID | 167857495 |
| Molecular Formula | C17H19ClN6O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [(4aS,7aS)-6-(6-chloro-5-methylpyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-pyrimidin-5-ylmethanone |
| SMILES | Cc1c(Cl)ncnc1N1C[C@@H]2CCCN(C(=O)c3cncnc3)[C@@H]2C1 |
| InChI | InChI=1S/C17H19ClN6O/c1-11-15(18)21-10-22-16(11)23-7-12-3-2-4-24(14(12)8-23)17(25)13-5-19-9-20-6-13/h5-6,9-10,12,14H,2-4,7-8H2,1H3/t12-,14+/m0/s1 |
| InChIKey | SWRXOJMJRIJDDI-GXTWGEPZSA-N |
| XLogP | 1.97 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |