C16H16N6OS — CID 167862408
N-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxamide (PubChem CID 167862408) has the molecular formula C16H16N6OS and a molecular weight of 340.41 g/mol. Its IUPAC name is N-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167862408 |
| Molecular Formula | C16H16N6OS |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCc1nc(-c2ccccn2)n[nH]1)c1cc2c(s1)CNCC2 |
| InChI | InChI=1S/C16H16N6OS/c23-16(12-7-10-4-6-17-8-13(10)24-12)19-9-14-20-15(22-21-14)11-3-1-2-5-18-11/h1-3,5,7,17H,4,6,8-9H2,(H,19,23)(H,20,21,22) |
| InChIKey | PXZOOXXHJNMLQT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |