C18H17FN6O — CID 167983534
6-fluoro-N-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-1,2,3,4-tetrahydroisoquinoline-8-carboxamide (PubChem CID 167983534) has the molecular formula C18H17FN6O and a molecular weight of 352.37 g/mol. Its IUPAC name is 6-fluoro-N-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-1,2,3,4-tetrahydroisoquinoline-8-carboxamide.
| Compound Name | 6-fluoro-N-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-1,2,3,4-tetrahydroisoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 167983534 |
| Molecular Formula | C18H17FN6O |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 6-fluoro-N-[(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methyl]-1,2,3,4-tetrahydroisoquinoline-8-carboxamide |
| SMILES | O=C(NCc1nc(-c2ccccn2)n[nH]1)c1cc(F)cc2c1CNCC2 |
| InChI | InChI=1S/C18H17FN6O/c19-12-7-11-4-6-20-9-14(11)13(8-12)18(26)22-10-16-23-17(25-24-16)15-3-1-2-5-21-15/h1-3,5,7-8,20H,4,6,9-10H2,(H,22,26)(H,23,24,25) |
| InChIKey | RFSKXRPAGURVLN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |