C27H27N3O3 — CID 167864313
N-[1-(3-acetamidophenyl)ethyl]-N-benzyl-3-(prop-2-enoylamino)benzamide (PubChem CID 167864313) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[1-(3-acetamidophenyl)ethyl]-N-benzyl-3-(prop-2-enoylamino)benzamide.
| Compound Name | N-[1-(3-acetamidophenyl)ethyl]-N-benzyl-3-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 167864313 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[1-(3-acetamidophenyl)ethyl]-N-benzyl-3-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1cccc(C(=O)N(Cc2ccccc2)C(C)c2cccc(NC(C)=O)c2)c1 |
| InChI | InChI=1S/C27H27N3O3/c1-4-26(32)29-25-15-9-13-23(17-25)27(33)30(18-21-10-6-5-7-11-21)19(2)22-12-8-14-24(16-22)28-20(3)31/h4-17,19H,1,18H2,2-3H3,(H,28,31)(H,29,32) |
| InChIKey | GSDFVOOEHLBOAZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|