C22H25N3O2 — CID 51932586
2-[[(1S)-1-(3-acetamidophenyl)ethyl]-benzylamino]-N-prop-2-ynylacetamide (PubChem CID 51932586) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[[(1S)-1-(3-acetamidophenyl)ethyl]-benzylamino]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[(1S)-1-(3-acetamidophenyl)ethyl]-benzylamino]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 51932586 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-[[(1S)-1-(3-acetamidophenyl)ethyl]-benzylamino]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CN(Cc1ccccc1)[C@@H](C)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-4-13-23-22(27)16-25(15-19-9-6-5-7-10-19)17(2)20-11-8-12-21(14-20)24-18(3)26/h1,5-12,14,17H,13,15-16H2,2-3H3,(H,23,27)(H,24,26)/t17-/m0/s1 |
| InChIKey | TUZFIOOJEFDDRO-KRWDZBQOSA-N |
| XLogP | 2.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|