C25H26N6O — CID 42896099
N-[3-[1-[benzyl-[(1-phenyltetrazol-5-yl)methyl]amino]ethyl]phenyl]acetamide (PubChem CID 42896099) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[3-[1-[benzyl-[(1-phenyltetrazol-5-yl)methyl]amino]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[1-[benzyl-[(1-phenyltetrazol-5-yl)methyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 42896099 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[3-[1-[benzyl-[(1-phenyltetrazol-5-yl)methyl]amino]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C(C)N(Cc2ccccc2)Cc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H26N6O/c1-19(22-12-9-13-23(16-22)26-20(2)32)30(17-21-10-5-3-6-11-21)18-25-27-28-29-31(25)24-14-7-4-8-15-24/h3-16,19H,17-18H2,1-2H3,(H,26,32) |
| InChIKey | WNTYHBUFMKFXSI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |