C19H22N6O2 — CID 47077786
2-methylpropyl N-[3-[(1-phenyltetrazol-5-yl)methylamino]phenyl]carbamate (PubChem CID 47077786) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-methylpropyl N-[3-[(1-phenyltetrazol-5-yl)methylamino]phenyl]carbamate.
| Compound Name | 2-methylpropyl N-[3-[(1-phenyltetrazol-5-yl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 47077786 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-methylpropyl N-[3-[(1-phenyltetrazol-5-yl)methylamino]phenyl]carbamate |
| SMILES | CC(C)COC(=O)Nc1cccc(NCc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C19H22N6O2/c1-14(2)13-27-19(26)21-16-8-6-7-15(11-16)20-12-18-22-23-24-25(18)17-9-4-3-5-10-17/h3-11,14,20H,12-13H2,1-2H3,(H,21,26) |
| InChIKey | XDPGTSFOEMSWCO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |