C16H14BrFN2O — CID 167864596
N-(3-bromo-5-methyl-2-pyridinyl)-5-cyclopropyl-2-fluorobenzamide (PubChem CID 167864596) has the molecular formula C16H14BrFN2O and a molecular weight of 349.20 g/mol. Its IUPAC name is N-(3-bromo-5-methyl-2-pyridinyl)-5-cyclopropyl-2-fluorobenzamide.
| Compound Name | N-(3-bromo-5-methyl-2-pyridinyl)-5-cyclopropyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 167864596 |
| Molecular Formula | C16H14BrFN2O |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | N-(3-bromo-5-methyl-2-pyridinyl)-5-cyclopropyl-2-fluorobenzamide |
| SMILES | Cc1cnc(NC(=O)c2cc(C3CC3)ccc2F)c(Br)c1 |
| InChI | InChI=1S/C16H14BrFN2O/c1-9-6-13(17)15(19-8-9)20-16(21)12-7-11(10-2-3-10)4-5-14(12)18/h4-8,10H,2-3H2,1H3,(H,19,20,21) |
| InChIKey | ONGVZKAXXUDGBN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |