C12H9BrClN3O — CID 75388632
N-(3-bromo-5-methyl-2-pyridinyl)-3-chloropyridine-4-carboxamide (PubChem CID 75388632) has the molecular formula C12H9BrClN3O and a molecular weight of 326.58 g/mol. Its IUPAC name is N-(3-bromo-5-methyl-2-pyridinyl)-3-chloropyridine-4-carboxamide.
| Compound Name | N-(3-bromo-5-methyl-2-pyridinyl)-3-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 75388632 |
| Molecular Formula | C12H9BrClN3O |
| Molecular Weight | 326.58 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | N-(3-bromo-5-methyl-2-pyridinyl)-3-chloropyridine-4-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2ccncc2Cl)c(Br)c1 |
| InChI | InChI=1S/C12H9BrClN3O/c1-7-4-9(13)11(16-5-7)17-12(18)8-2-3-15-6-10(8)14/h2-6H,1H3,(H,16,17,18) |
| InChIKey | PUMBEEVLSMIQDP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |