C14H22N4O4S — CID 167865189
[4-(4-morpholin-4-ylsulfonylpiperazin-1-yl)-3-pyridinyl]methanol (PubChem CID 167865189) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is [4-(4-morpholin-4-ylsulfonylpiperazin-1-yl)-3-pyridinyl]methanol.
| Compound Name | [4-(4-morpholin-4-ylsulfonylpiperazin-1-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 167865189 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [4-(4-morpholin-4-ylsulfonylpiperazin-1-yl)-3-pyridinyl]methanol |
| SMILES | O=S(=O)(N1CCOCC1)N1CCN(c2ccncc2CO)CC1 |
| InChI | InChI=1S/C14H22N4O4S/c19-12-13-11-15-2-1-14(13)16-3-5-17(6-4-16)23(20,21)18-7-9-22-10-8-18/h1-2,11,19H,3-10,12H2 |
| InChIKey | NXMGNDFBZGYCPF-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |