C13H17FN2 — CID 167866875
3-ethyl-2-[1-(3-fluorophenyl)ethyl]-3,4-dihydropyrazole (PubChem CID 167866875) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-ethyl-2-[1-(3-fluorophenyl)ethyl]-3,4-dihydropyrazole.
| Compound Name | 3-ethyl-2-[1-(3-fluorophenyl)ethyl]-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 167866875 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-ethyl-2-[1-(3-fluorophenyl)ethyl]-3,4-dihydropyrazole |
| SMILES | CCC1CC=NN1C(C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2/c1-3-13-7-8-15-16(13)10(2)11-5-4-6-12(14)9-11/h4-6,8-10,13H,3,7H2,1-2H3 |
| InChIKey | ISFPHKZVFAVSHE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |