About 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid
2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid (PubChem CID 167867842) has the molecular formula C17H24N2O4
and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid.
Molecular Properties
| Compound Name | 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid |
| PubChem CID | 167867842 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid |
| SMILES | CC1(C)CCCN1C(=O)NCC(Cc1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C17H24N2O4/c1-17(2)7-4-8-19(17)16(23)18-11-13(15(21)22)9-12-5-3-6-14(20)10-12/h3,5-6,10,13,20H,4,7-9,11H2,1-2H3,(H,18,23)(H,21,22) |
| InChIKey | PVFOUFPDKFQLFU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid?
The IUPAC name of 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid (CID 167867842) is 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid.
What is the SMILES notation for 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid?
The canonical SMILES for 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid is CC1(C)CCCN1C(=O)NCC(Cc1cccc(O)c1)C(=O)O.
What is the InChIKey of 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid?
The InChIKey is PVFOUFPDKFQLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O4/c1-17(2)7-4-8-19(17)16(23)18-11-13(15(21)22)9-12-5-3-6-14(20)10-12/h3,5-6,10,13,20H,4,7-9,11H2,1-2H3,(H,18,23)(H,21,22).
What are the key properties of 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid?
2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid has a molecular weight of 320.39 g/mol, XLogP of 2.22, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2,2-dimethylpyrrolidine-1-carbonyl)amino]methyl]-3-(3-hydroxyphenyl)propanoic acid is sourced from PubChem (CID 167867842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).