C15H24N2O3 — CID 16786884
1-(2,4-dimethoxyphenyl)-2-(2-methylmorpholin-4-yl)ethanamine (PubChem CID 16786884) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-(2-methylmorpholin-4-yl)ethanamine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-(2-methylmorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 16786884 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-(2-methylmorpholin-4-yl)ethanamine |
| SMILES | COc1ccc(C(N)CN2CCOC(C)C2)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-11-9-17(6-7-20-11)10-14(16)13-5-4-12(18-2)8-15(13)19-3/h4-5,8,11,14H,6-7,9-10,16H2,1-3H3 |
| InChIKey | JNOXDQKQXCOXHW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |