C15H18N2O3 — CID 62881699
1-[2-amino-2-(2,4-dimethoxyphenyl)ethyl]pyridin-4-one (PubChem CID 62881699) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-[2-amino-2-(2,4-dimethoxyphenyl)ethyl]pyridin-4-one.
| Compound Name | 1-[2-amino-2-(2,4-dimethoxyphenyl)ethyl]pyridin-4-one |
|---|---|
| PubChem CID | 62881699 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-[2-amino-2-(2,4-dimethoxyphenyl)ethyl]pyridin-4-one |
| SMILES | COc1ccc(C(N)Cn2ccc(=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-19-12-3-4-13(15(9-12)20-2)14(16)10-17-7-5-11(18)6-8-17/h3-9,14H,10,16H2,1-2H3 |
| InChIKey | VZTXNNYBUHJBMJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |