C21H18ClN3O3 — CID 167869744
N-[4-[[[2-(2-chloro-4-hydroxyphenyl)acetyl]amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 167869744) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is N-[4-[[[2-(2-chloro-4-hydroxyphenyl)acetyl]amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[[[2-(2-chloro-4-hydroxyphenyl)acetyl]amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167869744 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-[4-[[[2-(2-chloro-4-hydroxyphenyl)acetyl]amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Cc1ccc(O)cc1Cl)NCc1ccc(NC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C21H18ClN3O3/c22-19-11-18(26)8-5-15(19)10-20(27)24-12-14-3-6-17(7-4-14)25-21(28)16-2-1-9-23-13-16/h1-9,11,13,26H,10,12H2,(H,24,27)(H,25,28) |
| InChIKey | AQPYFSOJDAFRKR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |