C22H31N3O2 — CID 167872290
N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-1-azabicyclo[3.2.1]octane-5-carboxamide (PubChem CID 167872290) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-1-azabicyclo[3.2.1]octane-5-carboxamide.
| Compound Name | N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-1-azabicyclo[3.2.1]octane-5-carboxamide |
|---|---|
| PubChem CID | 167872290 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-1-azabicyclo[3.2.1]octane-5-carboxamide |
| SMILES | O=C(CNC(=O)C12CCCN(CC1)C2)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H31N3O2/c26-20(16-23-21(27)22-9-4-11-24(17-22)14-10-22)25-12-7-19(8-13-25)15-18-5-2-1-3-6-18/h1-3,5-6,19H,4,7-17H2,(H,23,27) |
| InChIKey | IYCJKQYFLHTZAK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |