C24H27N3O3 — CID 167874326
1-[(1-benzyl-3-hydroxypyrrolidin-3-yl)methyl]-3-[furan-3-yl(phenyl)methyl]urea (PubChem CID 167874326) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-[(1-benzyl-3-hydroxypyrrolidin-3-yl)methyl]-3-[furan-3-yl(phenyl)methyl]urea.
| Compound Name | 1-[(1-benzyl-3-hydroxypyrrolidin-3-yl)methyl]-3-[furan-3-yl(phenyl)methyl]urea |
|---|---|
| PubChem CID | 167874326 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-[(1-benzyl-3-hydroxypyrrolidin-3-yl)methyl]-3-[furan-3-yl(phenyl)methyl]urea |
| SMILES | O=C(NCC1(O)CCN(Cc2ccccc2)C1)NC(c1ccccc1)c1ccoc1 |
| InChI | InChI=1S/C24H27N3O3/c28-23(26-22(21-11-14-30-16-21)20-9-5-2-6-10-20)25-17-24(29)12-13-27(18-24)15-19-7-3-1-4-8-19/h1-11,14,16,22,29H,12-13,15,17-18H2,(H2,25,26,28) |
| InChIKey | KJCHWNZSXQGCKG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |