C17H19N3O3 — CID 167875306
methyl 1-(3-prop-2-enoxypyrrolidin-1-yl)-2,7-naphthyridine-3-carboxylate (PubChem CID 167875306) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 1-(3-prop-2-enoxypyrrolidin-1-yl)-2,7-naphthyridine-3-carboxylate.
| Compound Name | methyl 1-(3-prop-2-enoxypyrrolidin-1-yl)-2,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 167875306 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | methyl 1-(3-prop-2-enoxypyrrolidin-1-yl)-2,7-naphthyridine-3-carboxylate |
| SMILES | C=CCOC1CCN(c2nc(C(=O)OC)cc3ccncc23)C1 |
| InChI | InChI=1S/C17H19N3O3/c1-3-8-23-13-5-7-20(11-13)16-14-10-18-6-4-12(14)9-15(19-16)17(21)22-2/h3-4,6,9-10,13H,1,5,7-8,11H2,2H3 |
| InChIKey | LALPCMFCPSLTNW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|