C11H9BrN2O2 — CID 71748439
ethyl 1-bromo-2,7-naphthyridine-3-carboxylate (PubChem CID 71748439) has the molecular formula C11H9BrN2O2 and a molecular weight of 281.11 g/mol. Its IUPAC name is ethyl 1-bromo-2,7-naphthyridine-3-carboxylate.
| Compound Name | ethyl 1-bromo-2,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 71748439 |
| Molecular Formula | C11H9BrN2O2 |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | ethyl 1-bromo-2,7-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2ccncc2c(Br)n1 |
| InChI | InChI=1S/C11H9BrN2O2/c1-2-16-11(15)9-5-7-3-4-13-6-8(7)10(12)14-9/h3-6H,2H2,1H3 |
| InChIKey | PWMBDHCPLLGYSW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|