C21H24N2O2 — CID 167876285
(3aS,7aS)-2-[(3-pyridin-4-ylphenyl)methyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (PubChem CID 167876285) has the molecular formula C21H24N2O2 and a molecular weight of 336.43 g/mol. Its IUPAC name is (3aS,7aS)-2-[(3-pyridin-4-ylphenyl)methyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[(3-pyridin-4-ylphenyl)methyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 167876285 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (3aS,7aS)-2-[(3-pyridin-4-ylphenyl)methyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCCC[C@@H]1CN(Cc1cccc(-c3ccncc3)c1)C2 |
| InChI | InChI=1S/C21H24N2O2/c24-20(25)21-9-2-1-6-19(21)14-23(15-21)13-16-4-3-5-18(12-16)17-7-10-22-11-8-17/h3-5,7-8,10-12,19H,1-2,6,9,13-15H2,(H,24,25)/t19-,21-/m1/s1 |
| InChIKey | NBZZXIRGAWYEBM-TZIWHRDSSA-N |
| XLogP | 3.83 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |