C16H20N2O3S — CID 167876679
5-[(2-methyl-5-propan-2-ylphenyl)methoxy]pyridine-2-sulfonamide (PubChem CID 167876679) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 5-[(2-methyl-5-propan-2-ylphenyl)methoxy]pyridine-2-sulfonamide.
| Compound Name | 5-[(2-methyl-5-propan-2-ylphenyl)methoxy]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 167876679 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-[(2-methyl-5-propan-2-ylphenyl)methoxy]pyridine-2-sulfonamide |
| SMILES | Cc1ccc(C(C)C)cc1COc1ccc(S(N)(=O)=O)nc1 |
| InChI | InChI=1S/C16H20N2O3S/c1-11(2)13-5-4-12(3)14(8-13)10-21-15-6-7-16(18-9-15)22(17,19)20/h4-9,11H,10H2,1-3H3,(H2,17,19,20) |
| InChIKey | BQQGVJZFCFMZBZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |