About [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol
[(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol (PubChem CID 167878323) has the molecular formula C17H21F2NO
and a molecular weight of 293.36 g/mol. Its IUPAC name is [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol |
| PubChem CID | 167878323 |
| Molecular Formula | C17H21F2NO |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol |
| SMILES | OC[C@@]1(CNC2CC3(C2)CC3(F)F)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H21F2NO/c18-17(19)9-16(17)6-13(7-16)20-10-15(11-21)8-14(15)12-4-2-1-3-5-12/h1-5,13-14,20-21H,6-11H2/t13?,14-,15-,16?/m0/s1 |
| InChIKey | SLVIDCFWRWRNND-PYBGIAKNSA-N |
| XLogP | 2.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol?
The IUPAC name of [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol (CID 167878323) is [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol.
What is the SMILES notation for [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol?
The canonical SMILES for [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol is OC[C@@]1(CNC2CC3(C2)CC3(F)F)C[C@H]1c1ccccc1.
What is the InChIKey of [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol?
The InChIKey is SLVIDCFWRWRNND-PYBGIAKNSA-N. The full InChI is InChI=1S/C17H21F2NO/c18-17(19)9-16(17)6-13(7-16)20-10-15(11-21)8-14(15)12-4-2-1-3-5-12/h1-5,13-14,20-21H,6-11H2/t13?,14-,15-,16?/m0/s1.
What are the key properties of [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol?
[(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol has a molecular weight of 293.36 g/mol, XLogP of 2.93, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-1-[[(2,2-difluorospiro[2.3]hexan-5-yl)amino]methyl]-2-phenylcyclopropyl]methanol is sourced from PubChem (CID 167878323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).