C17H25N7O2 — CID 167879491
3-[(1S)-1-(6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-yl)ethyl]-1-methyl-1-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)urea (PubChem CID 167879491) has the molecular formula C17H25N7O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[(1S)-1-(6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-yl)ethyl]-1-methyl-1-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)urea.
| Compound Name | 3-[(1S)-1-(6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-yl)ethyl]-1-methyl-1-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)urea |
|---|---|
| PubChem CID | 167879491 |
| Molecular Formula | C17H25N7O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 3-[(1S)-1-(6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-3-yl)ethyl]-1-methyl-1-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)urea |
| SMILES | C[C@H](NC(=O)N(C)C1CCCc2c1cnn2C)c1nnc2n1CCOC2 |
| InChI | InChI=1S/C17H25N7O2/c1-11(16-21-20-15-10-26-8-7-24(15)16)19-17(25)22(2)13-5-4-6-14-12(13)9-18-23(14)3/h9,11,13H,4-8,10H2,1-3H3,(H,19,25)/t11-,13?/m0/s1 |
| InChIKey | RTMZZDUVNUVRGD-AMGKYWFPSA-N |
| XLogP | 1.32 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |